C19H13ClN2O2 — CID 86093145
6-[6-(4-chlorophenyl)-2-pyridinyl]-4H-1,4-benzoxazin-3-one (PubChem CID 86093145) has the molecular formula C19H13ClN2O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is 6-[6-(4-chlorophenyl)-2-pyridinyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[6-(4-chlorophenyl)-2-pyridinyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 86093145 |
| Molecular Formula | C19H13ClN2O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 6-[6-(4-chlorophenyl)-2-pyridinyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3cccc(-c4ccc(Cl)cc4)n3)cc2N1 |
| InChI | InChI=1S/C19H13ClN2O2/c20-14-7-4-12(5-8-14)15-2-1-3-16(21-15)13-6-9-18-17(10-13)22-19(23)11-24-18/h1-10H,11H2,(H,22,23) |
| InChIKey | MZIDVHRTZHCFOL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |