C12H11N3O3 — CID 116832523
6-[2-(methylamino)-1,3-oxazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 116832523) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 6-[2-(methylamino)-1,3-oxazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(methylamino)-1,3-oxazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116832523 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 6-[2-(methylamino)-1,3-oxazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CNc1nc(-c2ccc3c(c2)NC(=O)CO3)co1 |
| InChI | InChI=1S/C12H11N3O3/c1-13-12-15-9(5-18-12)7-2-3-10-8(4-7)14-11(16)6-17-10/h2-5H,6H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | AJQZQESXGCPQFR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |