C16H11NO3 — CID 11514498
6-(1-benzofuran-5-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 11514498) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 6-(1-benzofuran-5-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-benzofuran-5-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 11514498 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 6-(1-benzofuran-5-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3ccc4occc4c3)cc2N1 |
| InChI | InChI=1S/C16H11NO3/c18-16-9-20-15-4-2-11(8-13(15)17-16)10-1-3-14-12(7-10)5-6-19-14/h1-8H,9H2,(H,17,18) |
| InChIKey | XNNZVTAXECVFAA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |