C8H8NO2P — CID 142138259
6-phosphanyl-4H-1,4-benzoxazin-3-one (PubChem CID 142138259) has the molecular formula C8H8NO2P and a molecular weight of 181.13 g/mol. Its IUPAC name is 6-phosphanyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-phosphanyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 142138259 |
| Molecular Formula | C8H8NO2P |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 6-phosphanyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(P)cc2N1 |
| InChI | InChI=1S/C8H8NO2P/c10-8-4-11-7-2-1-5(12)3-6(7)9-8/h1-3H,4,12H2,(H,9,10) |
| InChIKey | UPCKCXROUPOQDZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|