C10H9F2NO2 — CID 84679492
6-(1,1-difluoroethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 84679492) has the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1,1-difluoroethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 84679492 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 6-(1,1-difluoroethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC(F)(F)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H9F2NO2/c1-10(11,12)6-2-3-8-7(4-6)13-9(14)5-15-8/h2-4H,5H2,1H3,(H,13,14) |
| InChIKey | BSZBFBKACXXMQI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |