C12H14N2O4 — CID 82480797
3-amino-3-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoic acid (PubChem CID 82480797) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-amino-3-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoic acid.
| Compound Name | 3-amino-3-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoic acid |
|---|---|
| PubChem CID | 82480797 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-amino-3-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoic acid |
| SMILES | CC(N)(CC(=O)O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H14N2O4/c1-12(13,5-11(16)17)7-2-3-9-8(4-7)14-10(15)6-18-9/h2-4H,5-6,13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | SQNFXIQIWLQYEN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |