C12H14N2O4 — CID 91351368
2-methoxy-2-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide (PubChem CID 91351368) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-methoxy-2-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide.
| Compound Name | 2-methoxy-2-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide |
|---|---|
| PubChem CID | 91351368 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-methoxy-2-(3-oxo-4H-1,4-benzoxazin-6-yl)propanamide |
| SMILES | COC(C)(C(N)=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H14N2O4/c1-12(17-2,11(13)16)7-3-4-9-8(5-7)14-10(15)6-18-9/h3-5H,6H2,1-2H3,(H2,13,16)(H,14,15) |
| InChIKey | ONHCXZOVWCMGFD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |