C15H19NO3 — CID 114212567
6-(4,4-dimethylpentanoyl)-4H-1,4-benzoxazin-3-one (PubChem CID 114212567) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-(4,4-dimethylpentanoyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4,4-dimethylpentanoyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 114212567 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 6-(4,4-dimethylpentanoyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)(C)CCC(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C15H19NO3/c1-15(2,3)7-6-12(17)10-4-5-13-11(8-10)16-14(18)9-19-13/h4-5,8H,6-7,9H2,1-3H3,(H,16,18) |
| InChIKey | CXNXXEAKIKEKMU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |