C17H20N2O4 — CID 110344918
1-(3-oxo-4H-1,4-benzoxazin-6-yl)-4-piperidin-1-ylbutane-1,4-dione (PubChem CID 110344918) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(3-oxo-4H-1,4-benzoxazin-6-yl)-4-piperidin-1-ylbutane-1,4-dione.
| Compound Name | 1-(3-oxo-4H-1,4-benzoxazin-6-yl)-4-piperidin-1-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 110344918 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(3-oxo-4H-1,4-benzoxazin-6-yl)-4-piperidin-1-ylbutane-1,4-dione |
| SMILES | O=C1COc2ccc(C(=O)CCC(=O)N3CCCCC3)cc2N1 |
| InChI | InChI=1S/C17H20N2O4/c20-14(5-7-17(22)19-8-2-1-3-9-19)12-4-6-15-13(10-12)18-16(21)11-23-15/h4,6,10H,1-3,5,7-9,11H2,(H,18,21) |
| InChIKey | QGSUKWWNNRHYEY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |