C13H13NO5 — CID 15035901
methyl 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoate (PubChem CID 15035901) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is methyl 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoate.
| Compound Name | methyl 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoate |
|---|---|
| PubChem CID | 15035901 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | methyl 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoate |
| SMILES | COC(=O)CCC(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H13NO5/c1-18-13(17)5-3-10(15)8-2-4-11-9(6-8)14-12(16)7-19-11/h2,4,6H,3,5,7H2,1H3,(H,14,16) |
| InChIKey | YECCDOSJUKSCMO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |