C12H10N2O3 — CID 116862102
4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanenitrile (PubChem CID 116862102) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanenitrile.
| Compound Name | 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanenitrile |
|---|---|
| PubChem CID | 116862102 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-oxo-4-(3-oxo-4H-1,4-benzoxazin-6-yl)butanenitrile |
| SMILES | N#CCCC(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H10N2O3/c13-5-1-2-10(15)8-3-4-11-9(6-8)14-12(16)7-17-11/h3-4,6H,1-2,7H2,(H,14,16) |
| InChIKey | SLCCXMHRWBZZAZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |