C13H12N2O3 — CID 116923719
2-(3-oxo-4H-1,4-benzoxazine-6-carbonyl)butanenitrile (PubChem CID 116923719) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzoxazine-6-carbonyl)butanenitrile.
| Compound Name | 2-(3-oxo-4H-1,4-benzoxazine-6-carbonyl)butanenitrile |
|---|---|
| PubChem CID | 116923719 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzoxazine-6-carbonyl)butanenitrile |
| SMILES | CCC(C#N)C(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H12N2O3/c1-2-8(6-14)13(17)9-3-4-11-10(5-9)15-12(16)7-18-11/h3-5,8H,2,7H2,1H3,(H,15,16) |
| InChIKey | SFUXFKNQZKGSPC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|