C12H13NO5S — CID 104518030
6-(2-methylsulfonylpropanoyl)-4H-1,4-benzoxazin-3-one (PubChem CID 104518030) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is 6-(2-methylsulfonylpropanoyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-methylsulfonylpropanoyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 104518030 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6-(2-methylsulfonylpropanoyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C(=O)c1ccc2c(c1)NC(=O)CO2)S(C)(=O)=O |
| InChI | InChI=1S/C12H13NO5S/c1-7(19(2,16)17)12(15)8-3-4-10-9(5-8)13-11(14)6-18-10/h3-5,7H,6H2,1-2H3,(H,13,14) |
| InChIKey | WXCHZOROQUUVHO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |