C14H15NO3 — CID 83154072
6-(2-cyclopropylpropanoyl)-4H-1,4-benzoxazin-3-one (PubChem CID 83154072) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-(2-cyclopropylpropanoyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-cyclopropylpropanoyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 83154072 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 6-(2-cyclopropylpropanoyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C(=O)c1ccc2c(c1)NC(=O)CO2)C1CC1 |
| InChI | InChI=1S/C14H15NO3/c1-8(9-2-3-9)14(17)10-4-5-12-11(6-10)15-13(16)7-18-12/h4-6,8-9H,2-3,7H2,1H3,(H,15,16) |
| InChIKey | CZHAELRZRDBNDO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |