C19H20N2O3 — CID 2398221
6-[(2S)-2-(dimethylamino)-3-phenylpropanoyl]-4H-1,4-benzoxazin-3-one (PubChem CID 2398221) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6-[(2S)-2-(dimethylamino)-3-phenylpropanoyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(2S)-2-(dimethylamino)-3-phenylpropanoyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2398221 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 6-[(2S)-2-(dimethylamino)-3-phenylpropanoyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CN(C)[C@@H](Cc1ccccc1)C(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C19H20N2O3/c1-21(2)16(10-13-6-4-3-5-7-13)19(23)14-8-9-17-15(11-14)20-18(22)12-24-17/h3-9,11,16H,10,12H2,1-2H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | WMZUYVAMXGNSAV-INIZCTEOSA-N |
| XLogP | 2.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |