C15H12N2O3 — CID 17429970
3-oxo-N-phenyl-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 17429970) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-oxo-N-phenyl-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | 3-oxo-N-phenyl-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 17429970 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-oxo-N-phenyl-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | O=C1COc2ccc(C(=O)Nc3ccccc3)cc2N1 |
| InChI | InChI=1S/C15H12N2O3/c18-14-9-20-13-7-6-10(8-12(13)17-14)15(19)16-11-4-2-1-3-5-11/h1-8H,9H2,(H,16,19)(H,17,18) |
| InChIKey | APHGQAZRGVESRD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |