C15H12N2O4 — CID 145472125
3-hydroxy-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide (PubChem CID 145472125) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 3-hydroxy-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide.
| Compound Name | 3-hydroxy-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide |
|---|---|
| PubChem CID | 145472125 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-hydroxy-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide |
| SMILES | O=C1COc2ccc(NC(=O)c3cccc(O)c3)cc2N1 |
| InChI | InChI=1S/C15H12N2O4/c18-11-3-1-2-9(6-11)15(20)16-10-4-5-13-12(7-10)17-14(19)8-21-13/h1-7,18H,8H2,(H,16,20)(H,17,19) |
| InChIKey | OSJCAIZEFONLDX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |