C13H11N3O5S2 — CID 55462745
N-(3-oxo-4H-1,4-benzoxazin-6-yl)-5-sulfamoylthiophene-3-carboxamide (PubChem CID 55462745) has the molecular formula C13H11N3O5S2 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-6-yl)-5-sulfamoylthiophene-3-carboxamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-5-sulfamoylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 55462745 |
| Molecular Formula | C13H11N3O5S2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-5-sulfamoylthiophene-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)Nc2ccc3c(c2)NC(=O)CO3)cs1 |
| InChI | InChI=1S/C13H11N3O5S2/c14-23(19,20)12-3-7(6-22-12)13(18)15-8-1-2-10-9(4-8)16-11(17)5-21-10/h1-4,6H,5H2,(H,15,18)(H,16,17)(H2,14,19,20) |
| InChIKey | ZVLJJJGJWZZBMT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |