C12H9N3O3S — CID 55133554
N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazole-4-carboxamide (PubChem CID 55133554) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55133554 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C1COc2ccc(NC(=O)c3cscn3)cc2N1 |
| InChI | InChI=1S/C12H9N3O3S/c16-11-4-18-10-2-1-7(3-8(10)15-11)14-12(17)9-5-19-6-13-9/h1-3,5-6H,4H2,(H,14,17)(H,15,16) |
| InChIKey | HBQPOAVOKDMTEB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |