C15H8F4N2O3 — CID 32974831
2,3,4,5-tetrafluoro-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide (PubChem CID 32974831) has the molecular formula C15H8F4N2O3 and a molecular weight of 340.23 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide |
|---|---|
| PubChem CID | 32974831 |
| Molecular Formula | C15H8F4N2O3 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(3-oxo-4H-1,4-benzoxazin-6-yl)benzamide |
| SMILES | O=C1COc2ccc(NC(=O)c3cc(F)c(F)c(F)c3F)cc2N1 |
| InChI | InChI=1S/C15H8F4N2O3/c16-8-4-7(12(17)14(19)13(8)18)15(23)20-6-1-2-10-9(3-6)21-11(22)5-24-10/h1-4H,5H2,(H,20,23)(H,21,22) |
| InChIKey | BKOMIDGGTQMQEZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|