C18H12N2O5 — CID 31020420
4-oxo-N-(3-oxo-4H-1,4-benzoxazin-6-yl)chromene-2-carboxamide (PubChem CID 31020420) has the molecular formula C18H12N2O5 and a molecular weight of 336.30 g/mol. Its IUPAC name is 4-oxo-N-(3-oxo-4H-1,4-benzoxazin-6-yl)chromene-2-carboxamide.
| Compound Name | 4-oxo-N-(3-oxo-4H-1,4-benzoxazin-6-yl)chromene-2-carboxamide |
|---|---|
| PubChem CID | 31020420 |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 4-oxo-N-(3-oxo-4H-1,4-benzoxazin-6-yl)chromene-2-carboxamide |
| SMILES | O=C1COc2ccc(NC(=O)c3cc(=O)c4ccccc4o3)cc2N1 |
| InChI | InChI=1S/C18H12N2O5/c21-13-8-16(25-14-4-2-1-3-11(13)14)18(23)19-10-5-6-15-12(7-10)20-17(22)9-24-15/h1-8H,9H2,(H,19,23)(H,20,22) |
| InChIKey | SZPWDJTXXNNMQB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |