C18H15N3O3 — CID 24515939
2-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1H-indole-3-carboxamide (PubChem CID 24515939) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1H-indole-3-carboxamide.
| Compound Name | 2-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 24515939 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C18H15N3O3/c1-10-17(12-4-2-3-5-13(12)19-10)18(23)20-11-6-7-15-14(8-11)21-16(22)9-24-15/h2-8,19H,9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | BPGUJURMCBIKAH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |