C16H13ClN2O3 — CID 110778268
3-chloro-N-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)benzamide (PubChem CID 110778268) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is 3-chloro-N-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)benzamide.
| Compound Name | 3-chloro-N-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)benzamide |
|---|---|
| PubChem CID | 110778268 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-chloro-N-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)benzamide |
| SMILES | O=C1CCOc2ccc(NC(=O)c3cccc(Cl)c3)cc2N1 |
| InChI | InChI=1S/C16H13ClN2O3/c17-11-3-1-2-10(8-11)16(21)18-12-4-5-14-13(9-12)19-15(20)6-7-22-14/h1-5,8-9H,6-7H2,(H,18,21)(H,19,20) |
| InChIKey | JZMNXYGABRHWBD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |