C10H11N3O3 — CID 82494236
(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)urea (PubChem CID 82494236) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is (4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)urea.
| Compound Name | (4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)urea |
|---|---|
| PubChem CID | 82494236 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)urea |
| SMILES | NC(=O)Nc1ccc2c(c1)NC(=O)CCO2 |
| InChI | InChI=1S/C10H11N3O3/c11-10(15)12-6-1-2-8-7(5-6)13-9(14)3-4-16-8/h1-2,5H,3-4H2,(H,13,14)(H3,11,12,15) |
| InChIKey | DXCCFGXJAHOGEC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |