C9H9NO3 — CID 82490641
7-hydroxy-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 82490641) has the molecular formula C9H9NO3 and a molecular weight of 179.18 g/mol. Its IUPAC name is 7-hydroxy-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 7-hydroxy-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82490641 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 7-hydroxy-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | O=C1CCOc2ccc(O)cc2N1 |
| InChI | InChI=1S/C9H9NO3/c11-6-1-2-8-7(5-6)10-9(12)3-4-13-8/h1-2,5,11H,3-4H2,(H,10,12) |
| InChIKey | QVWUVCPJEAKYCG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |