C13H15NO4 — CID 82498920
3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid (PubChem CID 82498920) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid.
| Compound Name | 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid |
|---|---|
| PubChem CID | 82498920 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc2c(c1)NC(=O)CCO2 |
| InChI | InChI=1S/C13H15NO4/c1-8(6-13(16)17)9-2-3-11-10(7-9)14-12(15)4-5-18-11/h2-3,7-8H,4-6H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | VIKZNYMDTLZMHV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |