3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid

C13H15NO4 — CID 82498920

IUPAC3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid
SMILESCC(CC(=O)O)c1ccc2c(c1)NC(=O)CCO2
InChIInChI=1S/C13H15NO4/c1-8(6-13(16)17)9-2-3-11-10(7-9)14-12(15)4-5-18-11/h2-3,7-8H,4-6H2,1H3,(H,14,15)(H,16,17)
InChIKeyVIKZNYMDTLZMHV-UHFFFAOYSA-N
MW249.27 g/mol
LogP1.99
Rot. Bonds3

About 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid

3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid (PubChem CID 82498920) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid.

Molecular Properties

Compound Name3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid
PubChem CID82498920
Molecular FormulaC13H15NO4
Molecular Weight249.27 g/mol
Exact Mass249.10
IUPAC Name3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid
SMILESCC(CC(=O)O)c1ccc2c(c1)NC(=O)CCO2
InChIInChI=1S/C13H15NO4/c1-8(6-13(16)17)9-2-3-11-10(7-9)14-12(15)4-5-18-11/h2-3,7-8H,4-6H2,1H3,(H,14,15)(H,16,17)
InChIKeyVIKZNYMDTLZMHV-UHFFFAOYSA-N
XLogP1.99
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.27
LogP ≤ 51.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid?
The IUPAC name of 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid (CID 82498920) is 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid.
What is the SMILES notation for 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid?
The canonical SMILES for 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid is CC(CC(=O)O)c1ccc2c(c1)NC(=O)CCO2.
What is the InChIKey of 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid?
The InChIKey is VIKZNYMDTLZMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-8(6-13(16)17)9-2-3-11-10(7-9)14-12(15)4-5-18-11/h2-3,7-8H,4-6H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid?
3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid has a molecular weight of 249.27 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)butanoic acid is sourced from PubChem (CID 82498920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).