2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid

C12H14N2O4 — CID 43135032

IUPAC2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid
SMILESCC(NCC(=O)O)c1ccc2c(c1)NC(=O)CO2
InChIInChI=1S/C12H14N2O4/c1-7(13-5-12(16)17)8-2-3-10-9(4-8)14-11(15)6-18-10/h2-4,7,13H,5-6H2,1H3,(H,14,15)(H,16,17)
InChIKeySAVSNJFSTSJKIF-UHFFFAOYSA-N
MW250.25 g/mol
LogP0.75
Rot. Bonds4

About 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid

2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid (PubChem CID 43135032) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid.

Molecular Properties

Compound Name2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid
PubChem CID43135032
Molecular FormulaC12H14N2O4
Molecular Weight250.25 g/mol
Exact Mass250.10
IUPAC Name2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid
SMILESCC(NCC(=O)O)c1ccc2c(c1)NC(=O)CO2
InChIInChI=1S/C12H14N2O4/c1-7(13-5-12(16)17)8-2-3-10-9(4-8)14-11(15)6-18-10/h2-4,7,13H,5-6H2,1H3,(H,14,15)(H,16,17)
InChIKeySAVSNJFSTSJKIF-UHFFFAOYSA-N
XLogP0.75
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.25
LogP ≤ 50.75
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid?
The IUPAC name of 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid (CID 43135032) is 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid.
What is the SMILES notation for 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid?
The canonical SMILES for 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid is CC(NCC(=O)O)c1ccc2c(c1)NC(=O)CO2.
What is the InChIKey of 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid?
The InChIKey is SAVSNJFSTSJKIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4/c1-7(13-5-12(16)17)8-2-3-10-9(4-8)14-11(15)6-18-10/h2-4,7,13H,5-6H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid?
2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid has a molecular weight of 250.25 g/mol, XLogP of 0.75, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]acetic acid is sourced from PubChem (CID 43135032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).