C13H18N4O3 — CID 83110297
2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]ethylurea (PubChem CID 83110297) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]ethylurea.
| Compound Name | 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]ethylurea |
|---|---|
| PubChem CID | 83110297 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]ethylurea |
| SMILES | CC(NCCNC(N)=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H18N4O3/c1-8(15-4-5-16-13(14)19)9-2-3-11-10(6-9)17-12(18)7-20-11/h2-3,6,8,15H,4-5,7H2,1H3,(H,17,18)(H3,14,16,19) |
| InChIKey | MJBCWRYKZSVWMU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|