2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid

C13H16N2O4 — CID 61499457

IUPAC2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid
SMILESCC(NC(C)c1ccc2c(c1)NC(=O)CO2)C(=O)O
InChIInChI=1S/C13H16N2O4/c1-7(14-8(2)13(17)18)9-3-4-11-10(5-9)15-12(16)6-19-11/h3-5,7-8,14H,6H2,1-2H3,(H,15,16)(H,17,18)
InChIKeyBYBSTMYPUOBMJX-UHFFFAOYSA-N
MW264.28 g/mol
LogP1.14
Rot. Bonds4

About 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid

2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid (PubChem CID 61499457) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid.

Molecular Properties

Compound Name2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid
PubChem CID61499457
Molecular FormulaC13H16N2O4
Molecular Weight264.28 g/mol
Exact Mass264.11
IUPAC Name2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid
SMILESCC(NC(C)c1ccc2c(c1)NC(=O)CO2)C(=O)O
InChIInChI=1S/C13H16N2O4/c1-7(14-8(2)13(17)18)9-3-4-11-10(5-9)15-12(16)6-19-11/h3-5,7-8,14H,6H2,1-2H3,(H,15,16)(H,17,18)
InChIKeyBYBSTMYPUOBMJX-UHFFFAOYSA-N
XLogP1.14
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 51.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid?
The IUPAC name of 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid (CID 61499457) is 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid.
What is the SMILES notation for 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid?
The canonical SMILES for 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid is CC(NC(C)c1ccc2c(c1)NC(=O)CO2)C(=O)O.
What is the InChIKey of 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid?
The InChIKey is BYBSTMYPUOBMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c1-7(14-8(2)13(17)18)9-3-4-11-10(5-9)15-12(16)6-19-11/h3-5,7-8,14H,6H2,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid?
2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid has a molecular weight of 264.28 g/mol, XLogP of 1.14, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylamino]propanoic acid is sourced from PubChem (CID 61499457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).