C10H11NO3 — CID 47003494
6-[(1R)-1-hydroxyethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 47003494) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 6-[(1R)-1-hydroxyethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(1R)-1-hydroxyethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 47003494 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 6-[(1R)-1-hydroxyethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@@H](O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H11NO3/c1-6(12)7-2-3-9-8(4-7)11-10(13)5-14-9/h2-4,6,12H,5H2,1H3,(H,11,13)/t6-/m1/s1 |
| InChIKey | MPRYXQYGRGVBMD-ZCFIWIBFSA-N |
| XLogP | 1.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |