C11H13ClN2O2 — CID 116915239
6-[chloro(dimethylamino)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 116915239) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 6-[chloro(dimethylamino)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[chloro(dimethylamino)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116915239 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 6-[chloro(dimethylamino)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CN(C)C(Cl)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C11H13ClN2O2/c1-14(2)11(12)7-3-4-9-8(5-7)13-10(15)6-16-9/h3-5,11H,6H2,1-2H3,(H,13,15) |
| InChIKey | CUBLLPDSNOTFAN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|