C16H22ClNO2 — CID 63436729
6-(1-chlorooctyl)-4H-1,4-benzoxazin-3-one (PubChem CID 63436729) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 6-(1-chlorooctyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-chlorooctyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 63436729 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 6-(1-chlorooctyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CCCCCCCC(Cl)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C16H22ClNO2/c1-2-3-4-5-6-7-13(17)12-8-9-15-14(10-12)18-16(19)11-20-15/h8-10,13H,2-7,11H2,1H3,(H,18,19) |
| InChIKey | HXVGBURMRNIBAN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|