C14H20N2O2 — CID 103930958
6-(hexan-3-ylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 103930958) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-(hexan-3-ylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(hexan-3-ylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 103930958 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 6-(hexan-3-ylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | CCCC(CC)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H20N2O2/c1-3-5-10(4-2)15-11-6-7-13-12(8-11)16-14(17)9-18-13/h6-8,10,15H,3-5,9H2,1-2H3,(H,16,17) |
| InChIKey | FDIKUTRKPPSXPU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|