C11H14N2O4 — CID 115121906
6-(2,3-dihydroxypropylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 115121906) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 6-(2,3-dihydroxypropylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,3-dihydroxypropylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115121906 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 6-(2,3-dihydroxypropylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(NCC(O)CO)cc2N1 |
| InChI | InChI=1S/C11H14N2O4/c14-5-8(15)4-12-7-1-2-10-9(3-7)13-11(16)6-17-10/h1-3,8,12,14-15H,4-6H2,(H,13,16) |
| InChIKey | FLAPECNVIIKOFQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|