C12H17N3O2 — CID 115201016
6-(4-aminobutylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 115201016) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-(4-aminobutylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-aminobutylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115201016 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-(4-aminobutylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | NCCCCNc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H17N3O2/c13-5-1-2-6-14-9-3-4-11-10(7-9)15-12(16)8-17-11/h3-4,7,14H,1-2,5-6,8,13H2,(H,15,16) |
| InChIKey | MKYTWHJTUSTEDU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|