C12H14N2O5 — CID 115122875
3-hydroxy-4-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]butanoic acid (PubChem CID 115122875) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-hydroxy-4-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]butanoic acid.
| Compound Name | 3-hydroxy-4-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 115122875 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-hydroxy-4-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]butanoic acid |
| SMILES | O=C(O)CC(O)CNc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H14N2O5/c15-8(4-12(17)18)5-13-7-1-2-10-9(3-7)14-11(16)6-19-10/h1-3,8,13,15H,4-6H2,(H,14,16)(H,17,18) |
| InChIKey | YGSCCYGREFEZTL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|