C13H17N3O3 — CID 81087224
4-amino-3-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide (PubChem CID 81087224) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-amino-3-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide.
| Compound Name | 4-amino-3-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide |
|---|---|
| PubChem CID | 81087224 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-amino-3-methyl-N-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide |
| SMILES | CC(CN)CC(=O)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H17N3O3/c1-8(6-14)4-12(17)15-9-2-3-11-10(5-9)16-13(18)7-19-11/h2-3,5,8H,4,6-7,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | FZTUGXWLQDOBBB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |