C13H17N3O4 — CID 62477125
2-amino-4-methoxy-N-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide (PubChem CID 62477125) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-amino-4-methoxy-N-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide.
| Compound Name | 2-amino-4-methoxy-N-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide |
|---|---|
| PubChem CID | 62477125 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-amino-4-methoxy-N-(3-oxo-4H-1,4-benzoxazin-6-yl)butanamide |
| SMILES | COCCC(N)C(=O)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H17N3O4/c1-19-5-4-9(14)13(18)15-8-2-3-11-10(6-8)16-12(17)7-20-11/h2-3,6,9H,4-5,7,14H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | AZGJAPNUSQFHBN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |