C13H18N2O4 — CID 168597522
6-(2,3-dihydroxypropylamino)-2,2-dimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 168597522) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-(2,3-dihydroxypropylamino)-2,2-dimethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,3-dihydroxypropylamino)-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 168597522 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-(2,3-dihydroxypropylamino)-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(NCC(O)CO)cc2NC1=O |
| InChI | InChI=1S/C13H18N2O4/c1-13(2)12(18)15-10-5-8(3-4-11(10)19-13)14-6-9(17)7-16/h3-5,9,14,16-17H,6-7H2,1-2H3,(H,15,18) |
| InChIKey | FZBTXIDVLWAIJX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|