C12H17NO3 — CID 168597315
3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol (PubChem CID 168597315) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 168597315 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol |
| SMILES | CC1Cc2cc(NCC(O)CO)ccc2O1 |
| InChI | InChI=1S/C12H17NO3/c1-8-4-9-5-10(2-3-12(9)16-8)13-6-11(15)7-14/h2-3,5,8,11,13-15H,4,6-7H2,1H3 |
| InChIKey | ZMXDWSVCCYPVAC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|