About 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol
3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol (PubChem CID 168597315) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol |
| PubChem CID | 168597315 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol |
| SMILES | CC1Cc2cc(NCC(O)CO)ccc2O1 |
| InChI | InChI=1S/C12H17NO3/c1-8-4-9-5-10(2-3-12(9)16-8)13-6-11(15)7-14/h2-3,5,8,11,13-15H,4,6-7H2,1H3 |
| InChIKey | ZMXDWSVCCYPVAC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol?
The IUPAC name of 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol (CID 168597315) is 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol.
What is the SMILES notation for 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol?
The canonical SMILES for 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol is CC1Cc2cc(NCC(O)CO)ccc2O1.
What is the InChIKey of 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol?
The InChIKey is ZMXDWSVCCYPVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-8-4-9-5-10(2-3-12(9)16-8)13-6-11(15)7-14/h2-3,5,8,11,13-15H,4,6-7H2,1H3.
What are the key properties of 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol?
3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol has a molecular weight of 223.27 g/mol, XLogP of 0.78, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]propane-1,2-diol is sourced from PubChem (CID 168597315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).