C11H17NO2 — CID 76891516
3-(3,4-dimethylanilino)propane-1,2-diol (PubChem CID 76891516) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-(3,4-dimethylanilino)propane-1,2-diol.
| Compound Name | 3-(3,4-dimethylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 76891516 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-(3,4-dimethylanilino)propane-1,2-diol |
| SMILES | Cc1ccc(NCC(O)CO)cc1C |
| InChI | InChI=1S/C11H17NO2/c1-8-3-4-10(5-9(8)2)12-6-11(14)7-13/h3-5,11-14H,6-7H2,1-2H3 |
| InChIKey | IFVHXRNNLCSFGA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |