C10H15NO2 — CID 3016394
3-(3-methylanilino)propane-1,2-diol (PubChem CID 3016394) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(3-methylanilino)propane-1,2-diol.
| Compound Name | 3-(3-methylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 3016394 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-(3-methylanilino)propane-1,2-diol |
| SMILES | Cc1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C10H15NO2/c1-8-3-2-4-9(5-8)11-6-10(13)7-12/h2-5,10-13H,6-7H2,1H3 |
| InChIKey | JODOBYDEHOMWRX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |