C12H18N2O4 — CID 168597581
ethyl N-[3-(2,3-dihydroxypropylamino)phenyl]carbamate (PubChem CID 168597581) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is ethyl N-[3-(2,3-dihydroxypropylamino)phenyl]carbamate.
| Compound Name | ethyl N-[3-(2,3-dihydroxypropylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 168597581 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethyl N-[3-(2,3-dihydroxypropylamino)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C12H18N2O4/c1-2-18-12(17)14-10-5-3-4-9(6-10)13-7-11(16)8-15/h3-6,11,13,15-16H,2,7-8H2,1H3,(H,14,17) |
| InChIKey | WKPFGYTVMACFMC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |