C17H20N2O3 — CID 168596635
3-(2,3-dihydroxypropylamino)-N-(2-methylphenyl)benzamide (PubChem CID 168596635) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylamino)-N-(2-methylphenyl)benzamide.
| Compound Name | 3-(2,3-dihydroxypropylamino)-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 168596635 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-(2,3-dihydroxypropylamino)-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)c1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C17H20N2O3/c1-12-5-2-3-8-16(12)19-17(22)13-6-4-7-14(9-13)18-10-15(21)11-20/h2-9,15,18,20-21H,10-11H2,1H3,(H,19,22) |
| InChIKey | WCANFXDVGORTCE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |