C18H22N2O3 — CID 168596784
2-(2,3-dihydroxypropylamino)-N-(2,5-dimethylphenyl)benzamide (PubChem CID 168596784) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-N-(2,5-dimethylphenyl)benzamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)-N-(2,5-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 168596784 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-N-(2,5-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2ccccc2NCC(O)CO)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-12-7-8-13(2)17(9-12)20-18(23)15-5-3-4-6-16(15)19-10-14(22)11-21/h3-9,14,19,21-22H,10-11H2,1-2H3,(H,20,23) |
| InChIKey | HDCRIRDWUGSFMG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |