C19H17NO — CID 1278696
N-(2,5-dimethylphenyl)naphthalene-1-carboxamide (PubChem CID 1278696) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)naphthalene-1-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 1278696 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(2,5-dimethylphenyl)naphthalene-1-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C19H17NO/c1-13-10-11-14(2)18(12-13)20-19(21)17-9-5-7-15-6-3-4-8-16(15)17/h3-12H,1-2H3,(H,20,21) |
| InChIKey | LYBBSNLRDXSSHI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |