C25H20N2O2 — CID 2988389
N-[4-[(2-methylphenyl)carbamoyl]phenyl]naphthalene-1-carboxamide (PubChem CID 2988389) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[4-[(2-methylphenyl)carbamoyl]phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[4-[(2-methylphenyl)carbamoyl]phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 2988389 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[4-[(2-methylphenyl)carbamoyl]phenyl]naphthalene-1-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1ccc(NC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H20N2O2/c1-17-7-2-5-12-23(17)27-24(28)19-13-15-20(16-14-19)26-25(29)22-11-6-9-18-8-3-4-10-21(18)22/h2-16H,1H3,(H,26,29)(H,27,28) |
| InChIKey | FSNPLBBDQLLMFY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |