C21H21NO3 — CID 143144416
ethane;5-methyl-2-(naphthalene-1-carbonylamino)benzoic acid (PubChem CID 143144416) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethane;5-methyl-2-(naphthalene-1-carbonylamino)benzoic acid.
| Compound Name | ethane;5-methyl-2-(naphthalene-1-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 143144416 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | ethane;5-methyl-2-(naphthalene-1-carbonylamino)benzoic acid |
| SMILES | CC.Cc1ccc(NC(=O)c2cccc3ccccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H15NO3.C2H6/c1-12-9-10-17(16(11-12)19(22)23)20-18(21)15-8-4-6-13-5-2-3-7-14(13)15;1-2/h2-11H,1H3,(H,20,21)(H,22,23);1-2H3 |
| InChIKey | GCZHMFIADRVNAL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |