C36H26N2O6 — CID 67617466
2-(naphthalen-1-ylcarbamoyl)benzoic acid (PubChem CID 67617466) has the molecular formula C36H26N2O6 and a molecular weight of 582.61 g/mol. Its IUPAC name is 2-(naphthalen-1-ylcarbamoyl)benzoic acid.
| Compound Name | 2-(naphthalen-1-ylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 67617466 |
| Molecular Formula | C36H26N2O6 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 2-(naphthalen-1-ylcarbamoyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1cccc2ccccc12.O=C(O)c1ccccc1C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/2C18H13NO3/c2*20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16/h2*1-11H,(H,19,20)(H,21,22) |
| InChIKey | BJAGEAKFMOLBRU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |