C16H12N2O3S — CID 16771814
2-(naphthalen-1-ylcarbamoylamino)thiophene-3-carboxylic acid (PubChem CID 16771814) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(naphthalen-1-ylcarbamoylamino)thiophene-3-carboxylic acid.
| Compound Name | 2-(naphthalen-1-ylcarbamoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 16771814 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-(naphthalen-1-ylcarbamoylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1sccc1C(=O)O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C16H12N2O3S/c19-15(20)12-8-9-22-14(12)18-16(21)17-13-7-3-5-10-4-1-2-6-11(10)13/h1-9H,(H,19,20)(H2,17,18,21) |
| InChIKey | AOHBGYVSHBNVIW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |